C16H20N4O5 — CID 169403958
ethyl 4-[5-(5-carbamoyl-2H-triazol-4-yl)-2-methoxyphenoxy]butanoate (PubChem CID 169403958) has the molecular formula C16H20N4O5 and a molecular weight of 348.36 g/mol. Its IUPAC name is ethyl 4-[5-(5-carbamoyl-2H-triazol-4-yl)-2-methoxyphenoxy]butanoate.
| Compound Name | ethyl 4-[5-(5-carbamoyl-2H-triazol-4-yl)-2-methoxyphenoxy]butanoate |
|---|---|
| PubChem CID | 169403958 |
| Molecular Formula | C16H20N4O5 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | ethyl 4-[5-(5-carbamoyl-2H-triazol-4-yl)-2-methoxyphenoxy]butanoate |
| SMILES | CCOC(=O)CCCOc1cc(-c2n[nH]nc2C(N)=O)ccc1OC |
| InChI | InChI=1S/C16H20N4O5/c1-3-24-13(21)5-4-8-25-12-9-10(6-7-11(12)23-2)14-15(16(17)22)19-20-18-14/h6-7,9H,3-5,8H2,1-2H3,(H2,17,22)(H,18,19,20) |
| InChIKey | YOFBXHRXDZNJLO-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 129.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|