About [4-(2-amino-3,5-dicarboxy-6-oxo-1H-pyridin-4-yl)phenyl]-trifluoroboranuide
[4-(2-amino-3,5-dicarboxy-6-oxo-1H-pyridin-4-yl)phenyl]-trifluoroboranuide (PubChem CID 169405264) has the molecular formula C13H9BF3N2O5-
and a molecular weight of 341.03 g/mol. Its IUPAC name is [4-(2-amino-3,5-dicarboxy-6-oxo-1H-pyridin-4-yl)phenyl]-trifluoroboranuide.
Molecular Properties
| Compound Name | [4-(2-amino-3,5-dicarboxy-6-oxo-1H-pyridin-4-yl)phenyl]-trifluoroboranuide |
| PubChem CID | 169405264 |
| Molecular Formula | C13H9BF3N2O5- |
| Molecular Weight | 341.03 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | [4-(2-amino-3,5-dicarboxy-6-oxo-1H-pyridin-4-yl)phenyl]-trifluoroboranuide |
| SMILES | Nc1[nH]c(=O)c(C(=O)O)c(-c2ccc([B-](F)(F)F)cc2)c1C(=O)O |
| InChI | InChI=1S/C13H9BF3N2O5/c15-14(16,17)6-3-1-5(2-4-6)7-8(12(21)22)10(18)19-11(20)9(7)13(23)24/h1-4H,(H,21,22)(H,23,24)(H3,18,19,20)/q-1 |
| InChIKey | QAJUOSXPRPWKDB-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 133.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.03 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [4-(2-amino-3,5-dicarboxy-6-oxo-1H-pyridin-4-yl)phenyl]-trifluoroboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-amino-3,5-dicarboxy-6-oxo-1H-pyridin-4-yl)phenyl]-trifluoroboranuide?
The IUPAC name of [4-(2-amino-3,5-dicarboxy-6-oxo-1H-pyridin-4-yl)phenyl]-trifluoroboranuide (CID 169405264) is [4-(2-amino-3,5-dicarboxy-6-oxo-1H-pyridin-4-yl)phenyl]-trifluoroboranuide.
What is the SMILES notation for [4-(2-amino-3,5-dicarboxy-6-oxo-1H-pyridin-4-yl)phenyl]-trifluoroboranuide?
The canonical SMILES for [4-(2-amino-3,5-dicarboxy-6-oxo-1H-pyridin-4-yl)phenyl]-trifluoroboranuide is Nc1[nH]c(=O)c(C(=O)O)c(-c2ccc([B-](F)(F)F)cc2)c1C(=O)O.
What is the InChIKey of [4-(2-amino-3,5-dicarboxy-6-oxo-1H-pyridin-4-yl)phenyl]-trifluoroboranuide?
The InChIKey is QAJUOSXPRPWKDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9BF3N2O5/c15-14(16,17)6-3-1-5(2-4-6)7-8(12(21)22)10(18)19-11(20)9(7)13(23)24/h1-4H,(H,21,22)(H,23,24)(H3,18,19,20)/q-1.
What are the key properties of [4-(2-amino-3,5-dicarboxy-6-oxo-1H-pyridin-4-yl)phenyl]-trifluoroboranuide?
[4-(2-amino-3,5-dicarboxy-6-oxo-1H-pyridin-4-yl)phenyl]-trifluoroboranuide has a molecular weight of 341.03 g/mol, XLogP of 1.07, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-amino-3,5-dicarboxy-6-oxo-1H-pyridin-4-yl)phenyl]-trifluoroboranuide is sourced from PubChem (CID 169405264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).