About 2-amino-4-(5-borono-2-propan-2-yloxyphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid
2-amino-4-(5-borono-2-propan-2-yloxyphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid (PubChem CID 169406245) has the molecular formula C16H17BN2O8
and a molecular weight of 376.13 g/mol. Its IUPAC name is 2-amino-4-(5-borono-2-propan-2-yloxyphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
Molecular Properties
| Compound Name | 2-amino-4-(5-borono-2-propan-2-yloxyphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
| PubChem CID | 169406245 |
| Molecular Formula | C16H17BN2O8 |
| Molecular Weight | 376.13 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 2-amino-4-(5-borono-2-propan-2-yloxyphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
| SMILES | CC(C)Oc1ccc(B(O)O)cc1-c1c(C(=O)O)c(N)[nH]c(=O)c1C(=O)O |
| InChI | InChI=1S/C16H17BN2O8/c1-6(2)27-9-4-3-7(17(25)26)5-8(9)10-11(15(21)22)13(18)19-14(20)12(10)16(23)24/h3-6,25-26H,1-2H3,(H,21,22)(H,23,24)(H3,18,19,20) |
| InChIKey | OOZCPKOUXIJFDC-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 183.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.13 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-(5-borono-2-propan-2-yloxyphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-(5-borono-2-propan-2-yloxyphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid?
The IUPAC name of 2-amino-4-(5-borono-2-propan-2-yloxyphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid (CID 169406245) is 2-amino-4-(5-borono-2-propan-2-yloxyphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
What is the SMILES notation for 2-amino-4-(5-borono-2-propan-2-yloxyphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid?
The canonical SMILES for 2-amino-4-(5-borono-2-propan-2-yloxyphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid is CC(C)Oc1ccc(B(O)O)cc1-c1c(C(=O)O)c(N)[nH]c(=O)c1C(=O)O.
What is the InChIKey of 2-amino-4-(5-borono-2-propan-2-yloxyphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid?
The InChIKey is OOZCPKOUXIJFDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17BN2O8/c1-6(2)27-9-4-3-7(17(25)26)5-8(9)10-11(15(21)22)13(18)19-14(20)12(10)16(23)24/h3-6,25-26H,1-2H3,(H,21,22)(H,23,24)(H3,18,19,20).
What are the key properties of 2-amino-4-(5-borono-2-propan-2-yloxyphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid?
2-amino-4-(5-borono-2-propan-2-yloxyphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid has a molecular weight of 376.13 g/mol, XLogP of -0.51, 6 rotatable bonds, 6 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-(5-borono-2-propan-2-yloxyphenyl)-6-oxo-1H-pyridine-3,5-dicarboxylic acid is sourced from PubChem (CID 169406245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).