About cyclopenta-2,4-diene-1-carboxylic acid;iron;methyl cyclopenta-2,4-diene-1-carboxylate
cyclopenta-2,4-diene-1-carboxylic acid;iron;methyl cyclopenta-2,4-diene-1-carboxylate (PubChem CID 169407960) has the molecular formula C13H12FeO4-2
and a molecular weight of 288.08 g/mol. Its IUPAC name is cyclopenta-2,4-diene-1-carboxylic acid;iron;methyl cyclopenta-2,4-diene-1-carboxylate.
Molecular Properties
| Compound Name | cyclopenta-2,4-diene-1-carboxylic acid;iron;methyl cyclopenta-2,4-diene-1-carboxylate |
| PubChem CID | 169407960 |
| Molecular Formula | C13H12FeO4-2 |
| Molecular Weight | 288.08 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | cyclopenta-2,4-diene-1-carboxylic acid;iron;methyl cyclopenta-2,4-diene-1-carboxylate |
| SMILES | COC(=O)[c-]1cccc1.O=C(O)[c-]1cccc1.[Fe] |
| InChI | InChI=1S/C7H7O2.C6H5O2.Fe/c1-9-7(8)6-4-2-3-5-6;7-6(8)5-3-1-2-4-5;/h2-5H,1H3;1-4H,(H,7,8);/q2*-1; |
| InChIKey | HNFNUSVFNMAHDI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.08 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-2,4-diene-1-carboxylic acid;iron;methyl cyclopenta-2,4-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-2,4-diene-1-carboxylic acid;iron;methyl cyclopenta-2,4-diene-1-carboxylate?
The IUPAC name of cyclopenta-2,4-diene-1-carboxylic acid;iron;methyl cyclopenta-2,4-diene-1-carboxylate (CID 169407960) is cyclopenta-2,4-diene-1-carboxylic acid;iron;methyl cyclopenta-2,4-diene-1-carboxylate.
What is the SMILES notation for cyclopenta-2,4-diene-1-carboxylic acid;iron;methyl cyclopenta-2,4-diene-1-carboxylate?
The canonical SMILES for cyclopenta-2,4-diene-1-carboxylic acid;iron;methyl cyclopenta-2,4-diene-1-carboxylate is COC(=O)[c-]1cccc1.O=C(O)[c-]1cccc1.[Fe].
What is the InChIKey of cyclopenta-2,4-diene-1-carboxylic acid;iron;methyl cyclopenta-2,4-diene-1-carboxylate?
The InChIKey is HNFNUSVFNMAHDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7O2.C6H5O2.Fe/c1-9-7(8)6-4-2-3-5-6;7-6(8)5-3-1-2-4-5;/h2-5H,1H3;1-4H,(H,7,8);/q2*-1;.
What are the key properties of cyclopenta-2,4-diene-1-carboxylic acid;iron;methyl cyclopenta-2,4-diene-1-carboxylate?
cyclopenta-2,4-diene-1-carboxylic acid;iron;methyl cyclopenta-2,4-diene-1-carboxylate has a molecular weight of 288.08 g/mol, XLogP of 2.29, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-2,4-diene-1-carboxylic acid;iron;methyl cyclopenta-2,4-diene-1-carboxylate is sourced from PubChem (CID 169407960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).