C6H9N3 — CID 169408722
1,2,3,3a,4,4-hexadeuteriobenzotriazole (PubChem CID 169408722) has the molecular formula C6H9N3 and a molecular weight of 129.20 g/mol. Its IUPAC name is 1,2,3,3a,4,4-hexadeuteriobenzotriazole.
| Compound Name | 1,2,3,3a,4,4-hexadeuteriobenzotriazole |
|---|---|
| PubChem CID | 169408722 |
| Molecular Formula | C6H9N3 |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | 1,2,3,3a,4,4-hexadeuteriobenzotriazole |
| SMILES | [2H]N1C2=CC=CC([2H])([2H])C2([2H])N([2H])N1[2H] |
| InChI | InChI=1S/C6H9N3/c1-2-4-6-5(3-1)7-9-8-6/h1-3,6-9H,4H2/i4D2,6D/hD3 |
| InChIKey | XEGAKAFEBOXGPV-DYCAQDRSSA-N |
| XLogP | -0.19 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |