About (3aS,6aS)-3a-propan-2-yl-4,6a-dihydro-3H-cyclopenta[b]furan-2-one
(3aS,6aS)-3a-propan-2-yl-4,6a-dihydro-3H-cyclopenta[b]furan-2-one (PubChem CID 169408911) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is (3aS,6aS)-3a-propan-2-yl-4,6a-dihydro-3H-cyclopenta[b]furan-2-one.
Molecular Properties
| Compound Name | (3aS,6aS)-3a-propan-2-yl-4,6a-dihydro-3H-cyclopenta[b]furan-2-one |
| PubChem CID | 169408911 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | (3aS,6aS)-3a-propan-2-yl-4,6a-dihydro-3H-cyclopenta[b]furan-2-one |
| SMILES | CC(C)[C@@]12CC=C[C@@H]1OC(=O)C2 |
| InChI | InChI=1S/C10H14O2/c1-7(2)10-5-3-4-8(10)12-9(11)6-10/h3-4,7-8H,5-6H2,1-2H3/t8-,10-/m0/s1 |
| InChIKey | JFMUJSUURFPCFR-WPRPVWTQSA-N |
| XLogP | 1.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3aS,6aS)-3a-propan-2-yl-4,6a-dihydro-3H-cyclopenta[b]furan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3aS,6aS)-3a-propan-2-yl-4,6a-dihydro-3H-cyclopenta[b]furan-2-one?
The IUPAC name of (3aS,6aS)-3a-propan-2-yl-4,6a-dihydro-3H-cyclopenta[b]furan-2-one (CID 169408911) is (3aS,6aS)-3a-propan-2-yl-4,6a-dihydro-3H-cyclopenta[b]furan-2-one.
What is the SMILES notation for (3aS,6aS)-3a-propan-2-yl-4,6a-dihydro-3H-cyclopenta[b]furan-2-one?
The canonical SMILES for (3aS,6aS)-3a-propan-2-yl-4,6a-dihydro-3H-cyclopenta[b]furan-2-one is CC(C)[C@@]12CC=C[C@@H]1OC(=O)C2.
What is the InChIKey of (3aS,6aS)-3a-propan-2-yl-4,6a-dihydro-3H-cyclopenta[b]furan-2-one?
The InChIKey is JFMUJSUURFPCFR-WPRPVWTQSA-N. The full InChI is InChI=1S/C10H14O2/c1-7(2)10-5-3-4-8(10)12-9(11)6-10/h3-4,7-8H,5-6H2,1-2H3/t8-,10-/m0/s1.
What are the key properties of (3aS,6aS)-3a-propan-2-yl-4,6a-dihydro-3H-cyclopenta[b]furan-2-one?
(3aS,6aS)-3a-propan-2-yl-4,6a-dihydro-3H-cyclopenta[b]furan-2-one has a molecular weight of 166.22 g/mol, XLogP of 1.90, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3aS,6aS)-3a-propan-2-yl-4,6a-dihydro-3H-cyclopenta[b]furan-2-one is sourced from PubChem (CID 169408911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).