C28H31ClN12O2 — CID 169409034
2-[[4-[4-[2,4-diamino-8-(4-chlorophenyl)-8,9-dihydro-7H-pyrimido[4,5-b][1,4]diazepin-6-yl]anilino]-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]ethanol (PubChem CID 169409034) has the molecular formula C28H31ClN12O2 and a molecular weight of 603.09 g/mol. Its IUPAC name is 2-[[4-[4-[2,4-diamino-8-(4-chlorophenyl)-8,9-dihydro-7H-pyrimido[4,5-b][1,4]diazepin-6-yl]anilino]-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]ethanol.
| Compound Name | 2-[[4-[4-[2,4-diamino-8-(4-chlorophenyl)-8,9-dihydro-7H-pyrimido[4,5-b][1,4]diazepin-6-yl]anilino]-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 169409034 |
| Molecular Formula | C28H31ClN12O2 |
| Molecular Weight | 603.09 g/mol |
| Exact Mass | 602.24 |
| IUPAC Name | 2-[[4-[4-[2,4-diamino-8-(4-chlorophenyl)-8,9-dihydro-7H-pyrimido[4,5-b][1,4]diazepin-6-yl]anilino]-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]ethanol |
| SMILES | Nc1nc(N)c2c(n1)NC(c1ccc(Cl)cc1)CC(c1ccc(Nc3nc(NCCO)nc(N4CCOCC4)n3)cc1)=N2 |
| InChI | InChI=1S/C28H31ClN12O2/c29-18-5-1-16(2-6-18)21-15-20(34-22-23(30)36-25(31)37-24(22)35-21)17-3-7-19(8-4-17)33-27-38-26(32-9-12-42)39-28(40-27)41-10-13-43-14-11-41/h1-8,21,42H,9-15H2,(H5,30,31,35,36,37)(H2,32,33,38,39,40) |
| InChIKey | KQVOGZKQGRJJJB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 197.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.09 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |