C12H13FN4O2S — CID 169409434
3-(3-fluoropropyl)-6-(4-methylsulfonylphenyl)-1,2,4,5-tetrazine (PubChem CID 169409434) has the molecular formula C12H13FN4O2S and a molecular weight of 296.33 g/mol. Its IUPAC name is 3-(3-fluoropropyl)-6-(4-methylsulfonylphenyl)-1,2,4,5-tetrazine.
| Compound Name | 3-(3-fluoropropyl)-6-(4-methylsulfonylphenyl)-1,2,4,5-tetrazine |
|---|---|
| PubChem CID | 169409434 |
| Molecular Formula | C12H13FN4O2S |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 3-(3-fluoropropyl)-6-(4-methylsulfonylphenyl)-1,2,4,5-tetrazine |
| SMILES | CS(=O)(=O)c1ccc(-c2nnc(CCCF)nn2)cc1 |
| InChI | InChI=1S/C12H13FN4O2S/c1-20(18,19)10-6-4-9(5-7-10)12-16-14-11(15-17-12)3-2-8-13/h4-7H,2-3,8H2,1H3 |
| InChIKey | ZXZKWWRNUHQDOX-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 85.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |