C20H35NO — CID 169409504
(3R,6E,10E)-14-hydroxy-6,10-dimethyl-3-propan-2-ylpentadeca-6,10-dienenitrile (PubChem CID 169409504) has the molecular formula C20H35NO and a molecular weight of 305.51 g/mol. Its IUPAC name is (3R,6E,10E)-14-hydroxy-6,10-dimethyl-3-propan-2-ylpentadeca-6,10-dienenitrile.
| Compound Name | (3R,6E,10E)-14-hydroxy-6,10-dimethyl-3-propan-2-ylpentadeca-6,10-dienenitrile |
|---|---|
| PubChem CID | 169409504 |
| Molecular Formula | C20H35NO |
| Molecular Weight | 305.51 g/mol |
| Exact Mass | 305.27 |
| IUPAC Name | (3R,6E,10E)-14-hydroxy-6,10-dimethyl-3-propan-2-ylpentadeca-6,10-dienenitrile |
| SMILES | C/C(=C\CCC(C)O)CC/C=C(\C)CC[C@H](CC#N)C(C)C |
| InChI | InChI=1S/C20H35NO/c1-16(2)20(14-15-21)13-12-18(4)9-6-8-17(3)10-7-11-19(5)22/h9-10,16,19-20,22H,6-8,11-14H2,1-5H3/b17-10+,18-9+/t19?,20-/m1/s1 |
| InChIKey | HQRNIKYIWTZVRR-KTXWJRICSA-N |
| XLogP | 5.79 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.51 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|