C18H18N4O3S — CID 169409562
3-(6-phenyl-1,2,4,5-tetrazin-3-yl)propyl 4-methylbenzenesulfonate (PubChem CID 169409562) has the molecular formula C18H18N4O3S and a molecular weight of 370.43 g/mol. Its IUPAC name is 3-(6-phenyl-1,2,4,5-tetrazin-3-yl)propyl 4-methylbenzenesulfonate.
| Compound Name | 3-(6-phenyl-1,2,4,5-tetrazin-3-yl)propyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 169409562 |
| Molecular Formula | C18H18N4O3S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 3-(6-phenyl-1,2,4,5-tetrazin-3-yl)propyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCc2nnc(-c3ccccc3)nn2)cc1 |
| InChI | InChI=1S/C18H18N4O3S/c1-14-9-11-16(12-10-14)26(23,24)25-13-5-8-17-19-21-18(22-20-17)15-6-3-2-4-7-15/h2-4,6-7,9-12H,5,8,13H2,1H3 |
| InChIKey | UZDFKGVJLVHODV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 94.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|