C18H17FN4O3S2 — CID 169409591
ethyl (E)-2-cyano-3-[[5-[(4-fluorophenyl)carbamoyl]-4-methyl-1,3-thiazol-2-yl]amino]-3-methylsulfanylprop-2-enoate (PubChem CID 169409591) has the molecular formula C18H17FN4O3S2 and a molecular weight of 420.49 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-[[5-[(4-fluorophenyl)carbamoyl]-4-methyl-1,3-thiazol-2-yl]amino]-3-methylsulfanylprop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-[[5-[(4-fluorophenyl)carbamoyl]-4-methyl-1,3-thiazol-2-yl]amino]-3-methylsulfanylprop-2-enoate |
|---|---|
| PubChem CID | 169409591 |
| Molecular Formula | C18H17FN4O3S2 |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | ethyl (E)-2-cyano-3-[[5-[(4-fluorophenyl)carbamoyl]-4-methyl-1,3-thiazol-2-yl]amino]-3-methylsulfanylprop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C(\Nc1nc(C)c(C(=O)Nc2ccc(F)cc2)s1)SC |
| InChI | InChI=1S/C18H17FN4O3S2/c1-4-26-17(25)13(9-20)16(27-3)23-18-21-10(2)14(28-18)15(24)22-12-7-5-11(19)6-8-12/h5-8H,4H2,1-3H3,(H,21,23)(H,22,24)/b16-13+ |
| InChIKey | AAMSPZHRGIWJFS-DTQAZKPQSA-N |
| XLogP | 3.92 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|