C29H26BrNO4 — CID 169409735
dibenzyl 4-(4-bromophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 169409735) has the molecular formula C29H26BrNO4 and a molecular weight of 532.43 g/mol. Its IUPAC name is dibenzyl 4-(4-bromophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | dibenzyl 4-(4-bromophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 169409735 |
| Molecular Formula | C29H26BrNO4 |
| Molecular Weight | 532.43 g/mol |
| Exact Mass | 531.10 |
| IUPAC Name | dibenzyl 4-(4-bromophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CC1=C(C(=O)OCc2ccccc2)C(c2ccc(Br)cc2)C(C(=O)OCc2ccccc2)=C(C)N1 |
| InChI | InChI=1S/C29H26BrNO4/c1-19-25(28(32)34-17-21-9-5-3-6-10-21)27(23-13-15-24(30)16-14-23)26(20(2)31-19)29(33)35-18-22-11-7-4-8-12-22/h3-16,27,31H,17-18H2,1-2H3 |
| InChIKey | AMCGWQQRSBOJMK-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.43 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |