C19H16N6O2 — CID 169410226
3-methyl-N-(4-methylphenyl)-1-(4-nitrophenyl)pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 169410226) has the molecular formula C19H16N6O2 and a molecular weight of 360.38 g/mol. Its IUPAC name is 3-methyl-N-(4-methylphenyl)-1-(4-nitrophenyl)pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 3-methyl-N-(4-methylphenyl)-1-(4-nitrophenyl)pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 169410226 |
| Molecular Formula | C19H16N6O2 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 3-methyl-N-(4-methylphenyl)-1-(4-nitrophenyl)pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Cc1ccc(Nc2ncnc3c2c(C)nn3-c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C19H16N6O2/c1-12-3-5-14(6-4-12)22-18-17-13(2)23-24(19(17)21-11-20-18)15-7-9-16(10-8-15)25(26)27/h3-11H,1-2H3,(H,20,21,22) |
| InChIKey | MVDNMBYCEVSHHL-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|