C17H18O — CID 169410347
6-(2-methylphenyl)-1,2,3,4-tetrahydronaphthalen-1-ol (PubChem CID 169410347) has the molecular formula C17H18O and a molecular weight of 238.33 g/mol. Its IUPAC name is 6-(2-methylphenyl)-1,2,3,4-tetrahydronaphthalen-1-ol.
| Compound Name | 6-(2-methylphenyl)-1,2,3,4-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 169410347 |
| Molecular Formula | C17H18O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 6-(2-methylphenyl)-1,2,3,4-tetrahydronaphthalen-1-ol |
| SMILES | Cc1ccccc1-c1ccc2c(c1)CCCC2O |
| InChI | InChI=1S/C17H18O/c1-12-5-2-3-7-15(12)14-9-10-16-13(11-14)6-4-8-17(16)18/h2-3,5,7,9-11,17-18H,4,6,8H2,1H3 |
| InChIKey | DUETWDNSAGADOR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |