C40H68 — CID 169410412
6-[(1E,13E,17E,19E)-3,7,12,16,20,24-hexamethylpentacosa-1,13,17,19,23-pentaenyl]-1,5,5-trimethylcyclohexene (PubChem CID 169410412) has the molecular formula C40H68 and a molecular weight of 548.98 g/mol. Its IUPAC name is 6-[(1E,13E,17E,19E)-3,7,12,16,20,24-hexamethylpentacosa-1,13,17,19,23-pentaenyl]-1,5,5-trimethylcyclohexene.
| Compound Name | 6-[(1E,13E,17E,19E)-3,7,12,16,20,24-hexamethylpentacosa-1,13,17,19,23-pentaenyl]-1,5,5-trimethylcyclohexene |
|---|---|
| PubChem CID | 169410412 |
| Molecular Formula | C40H68 |
| Molecular Weight | 548.98 g/mol |
| Exact Mass | 548.53 |
| IUPAC Name | 6-[(1E,13E,17E,19E)-3,7,12,16,20,24-hexamethylpentacosa-1,13,17,19,23-pentaenyl]-1,5,5-trimethylcyclohexene |
| SMILES | CC(C)=CCC/C(C)=C/C=C/C(C)C/C=C/C(C)CCCCC(C)CCCC(C)/C=C/C1C(C)=CCCC1(C)C |
| InChI | InChI=1S/C40H68/c1-32(2)18-13-21-35(5)24-15-26-36(6)25-14-22-33(3)19-11-12-20-34(4)23-16-27-37(7)29-30-39-38(8)28-17-31-40(39,9)10/h14-15,18,22,24,26,28-30,33-34,36-37,39H,11-13,16-17,19-21,23,25,27,31H2,1-10H3/b22-14+,26-15+,30-29+,35-24+ |
| InChIKey | NODWJQPJCDDZBY-YMVOFPGCSA-N |
| XLogP | 13.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.98 |
| LogP ≤ 5 | 13.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|