C40H66 — CID 169410417
6-[(4Z,7E,14E,17E,19E)-3,7,12,16,20,24-hexamethylpentacosa-4,7,14,17,19,23-hexaenyl]-1,5,5-trimethylcyclohexene (PubChem CID 169410417) has the molecular formula C40H66 and a molecular weight of 546.97 g/mol. Its IUPAC name is 6-[(4Z,7E,14E,17E,19E)-3,7,12,16,20,24-hexamethylpentacosa-4,7,14,17,19,23-hexaenyl]-1,5,5-trimethylcyclohexene.
| Compound Name | 6-[(4Z,7E,14E,17E,19E)-3,7,12,16,20,24-hexamethylpentacosa-4,7,14,17,19,23-hexaenyl]-1,5,5-trimethylcyclohexene |
|---|---|
| PubChem CID | 169410417 |
| Molecular Formula | C40H66 |
| Molecular Weight | 546.97 g/mol |
| Exact Mass | 546.52 |
| IUPAC Name | 6-[(4Z,7E,14E,17E,19E)-3,7,12,16,20,24-hexamethylpentacosa-4,7,14,17,19,23-hexaenyl]-1,5,5-trimethylcyclohexene |
| SMILES | CC(C)=CCC/C(C)=C/C=C/C(C)/C=C/CC(C)CCC/C=C(\C)C/C=C\C(C)CCC1C(C)=CCCC1(C)C |
| InChI | InChI=1S/C40H66/c1-32(2)18-13-21-35(5)24-15-26-36(6)25-14-22-33(3)19-11-12-20-34(4)23-16-27-37(7)29-30-39-38(8)28-17-31-40(39,9)10/h14-16,18,20,24-28,33,36-37,39H,11-13,17,19,21-23,29-31H2,1-10H3/b25-14+,26-15+,27-16-,34-20+,35-24+ |
| InChIKey | SDVZMNNYONPIAG-NTIAPDMFSA-N |
| XLogP | 13.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.97 |
| LogP ≤ 5 | 13.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|