C40H70 — CID 169410418
6-[(1E,17E,19E)-3,7,12,16,20,24-hexamethylpentacosa-1,17,19,23-tetraenyl]-1,5,5-trimethylcyclohexene (PubChem CID 169410418) has the molecular formula C40H70 and a molecular weight of 551.00 g/mol. Its IUPAC name is 6-[(1E,17E,19E)-3,7,12,16,20,24-hexamethylpentacosa-1,17,19,23-tetraenyl]-1,5,5-trimethylcyclohexene.
| Compound Name | 6-[(1E,17E,19E)-3,7,12,16,20,24-hexamethylpentacosa-1,17,19,23-tetraenyl]-1,5,5-trimethylcyclohexene |
|---|---|
| PubChem CID | 169410418 |
| Molecular Formula | C40H70 |
| Molecular Weight | 551.00 g/mol |
| Exact Mass | 550.55 |
| IUPAC Name | 6-[(1E,17E,19E)-3,7,12,16,20,24-hexamethylpentacosa-1,17,19,23-tetraenyl]-1,5,5-trimethylcyclohexene |
| SMILES | CC(C)=CCC/C(C)=C/C=C/C(C)CCCC(C)CCCCC(C)CCCC(C)/C=C/C1C(C)=CCCC1(C)C |
| InChI | InChI=1S/C40H70/c1-32(2)18-13-21-35(5)24-15-26-36(6)25-14-22-33(3)19-11-12-20-34(4)23-16-27-37(7)29-30-39-38(8)28-17-31-40(39,9)10/h15,18,24,26,28-30,33-34,36-37,39H,11-14,16-17,19-23,25,27,31H2,1-10H3/b26-15+,30-29+,35-24+ |
| InChIKey | HTCFSIWSPDGRJV-WBCSUQMBSA-N |
| XLogP | 13.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.00 |
| LogP ≤ 5 | 13.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|