C21H25N3O3S — CID 169410674
[(1S,4S)-2-azabicyclo[2.2.1]heptan-2-yl]-[1'-(1,3-oxazol-2-yl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2-yl]methanone (PubChem CID 169410674) has the molecular formula C21H25N3O3S and a molecular weight of 399.52 g/mol. Its IUPAC name is [(1S,4S)-2-azabicyclo[2.2.1]heptan-2-yl]-[1'-(1,3-oxazol-2-yl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2-yl]methanone.
| Compound Name | [(1S,4S)-2-azabicyclo[2.2.1]heptan-2-yl]-[1'-(1,3-oxazol-2-yl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2-yl]methanone |
|---|---|
| PubChem CID | 169410674 |
| Molecular Formula | C21H25N3O3S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | [(1S,4S)-2-azabicyclo[2.2.1]heptan-2-yl]-[1'-(1,3-oxazol-2-yl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2-yl]methanone |
| SMILES | O=C(c1cc2c(s1)C1(CCN(c3ncco3)CC1)OCC2)N1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C21H25N3O3S/c25-19(24-13-14-1-2-16(24)11-14)17-12-15-3-9-27-21(18(15)28-17)4-7-23(8-5-21)20-22-6-10-26-20/h6,10,12,14,16H,1-5,7-9,11,13H2/t14-,16-/m0/s1 |
| InChIKey | OBRCNRJQCNFTLS-HOCLYGCPSA-N |
| XLogP | 3.43 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |