C32H36FN3O4 — CID 169411167
3-(6-aminohexanoyl)-13-fluoro-11,23-dioxa-3,19-diazapentacyclo[22.3.1.16,10.112,16.02,7]triaconta-1(28),6,8,10(30),12,14,16(29),24,26-nonaen-18-one (PubChem CID 169411167) has the molecular formula C32H36FN3O4 and a molecular weight of 545.66 g/mol. Its IUPAC name is 3-(6-aminohexanoyl)-13-fluoro-11,23-dioxa-3,19-diazapentacyclo[22.3.1.16,10.112,16.02,7]triaconta-1(28),6,8,10(30),12,14,16(29),24,26-nonaen-18-one.
| Compound Name | 3-(6-aminohexanoyl)-13-fluoro-11,23-dioxa-3,19-diazapentacyclo[22.3.1.16,10.112,16.02,7]triaconta-1(28),6,8,10(30),12,14,16(29),24,26-nonaen-18-one |
|---|---|
| PubChem CID | 169411167 |
| Molecular Formula | C32H36FN3O4 |
| Molecular Weight | 545.66 g/mol |
| Exact Mass | 545.27 |
| IUPAC Name | 3-(6-aminohexanoyl)-13-fluoro-11,23-dioxa-3,19-diazapentacyclo[22.3.1.16,10.112,16.02,7]triaconta-1(28),6,8,10(30),12,14,16(29),24,26-nonaen-18-one |
| SMILES | NCCCCCC(=O)N1CCc2cc3ccc2C1c1cccc(c1)OCCCNC(=O)Cc1ccc(F)c(c1)O3 |
| InChI | InChI=1S/C32H36FN3O4/c33-28-12-9-22-18-29(28)40-26-10-11-27-23(20-26)13-16-36(31(38)8-2-1-3-14-34)32(27)24-6-4-7-25(21-24)39-17-5-15-35-30(37)19-22/h4,6-7,9-12,18,20-21,32H,1-3,5,8,13-17,19,34H2,(H,35,37) |
| InChIKey | LEVPALMGAAURKR-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.66 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|