C23H22FN3OS — CID 169411370
(3-fluoro-5-pyrimidin-5-ylphenyl)-[4-(4-methylphenyl)sulfanylpiperidin-1-yl]methanone (PubChem CID 169411370) has the molecular formula C23H22FN3OS and a molecular weight of 407.51 g/mol. Its IUPAC name is (3-fluoro-5-pyrimidin-5-ylphenyl)-[4-(4-methylphenyl)sulfanylpiperidin-1-yl]methanone.
| Compound Name | (3-fluoro-5-pyrimidin-5-ylphenyl)-[4-(4-methylphenyl)sulfanylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 169411370 |
| Molecular Formula | C23H22FN3OS |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | (3-fluoro-5-pyrimidin-5-ylphenyl)-[4-(4-methylphenyl)sulfanylpiperidin-1-yl]methanone |
| SMILES | Cc1ccc(SC2CCN(C(=O)c3cc(F)cc(-c4cncnc4)c3)CC2)cc1 |
| InChI | InChI=1S/C23H22FN3OS/c1-16-2-4-21(5-3-16)29-22-6-8-27(9-7-22)23(28)18-10-17(11-20(24)12-18)19-13-25-15-26-14-19/h2-5,10-15,22H,6-9H2,1H3 |
| InChIKey | YNUMMNWVZQSGGT-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |