C15H16N2O4S — CID 169412042
5,6,7-trimethoxy-4-(1,2-thiazol-4-yl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 169412042) has the molecular formula C15H16N2O4S and a molecular weight of 320.37 g/mol. Its IUPAC name is 5,6,7-trimethoxy-4-(1,2-thiazol-4-yl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 5,6,7-trimethoxy-4-(1,2-thiazol-4-yl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 169412042 |
| Molecular Formula | C15H16N2O4S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 5,6,7-trimethoxy-4-(1,2-thiazol-4-yl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | COc1cc2c(c(OC)c1OC)C(c1cnsc1)CC(=O)N2 |
| InChI | InChI=1S/C15H16N2O4S/c1-19-11-5-10-13(15(21-3)14(11)20-2)9(4-12(18)17-10)8-6-16-22-7-8/h5-7,9H,4H2,1-3H3,(H,17,18) |
| InChIKey | TXHIOJBEVVQZML-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |