C21H30N4O3 — CID 169412519
(1R,2S,8R,9S)-8-[(dimethylamino)methyl]-11-[2-(2-oxo-1-pyridinyl)acetyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 169412519) has the molecular formula C21H30N4O3 and a molecular weight of 386.50 g/mol. Its IUPAC name is (1R,2S,8R,9S)-8-[(dimethylamino)methyl]-11-[2-(2-oxo-1-pyridinyl)acetyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | (1R,2S,8R,9S)-8-[(dimethylamino)methyl]-11-[2-(2-oxo-1-pyridinyl)acetyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 169412519 |
| Molecular Formula | C21H30N4O3 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | (1R,2S,8R,9S)-8-[(dimethylamino)methyl]-11-[2-(2-oxo-1-pyridinyl)acetyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | CN(C)C[C@H]1[C@H]2C[C@H](CN(C(=O)Cn3ccccc3=O)C2)[C@@H]2CCCC(=O)N21 |
| InChI | InChI=1S/C21H30N4O3/c1-22(2)13-18-16-10-15(17-6-5-8-20(27)25(17)18)11-24(12-16)21(28)14-23-9-4-3-7-19(23)26/h3-4,7,9,15-18H,5-6,8,10-14H2,1-2H3/t15-,16+,17+,18+/m1/s1 |
| InChIKey | WQZSEAJCRWTZNG-OWSLCNJRSA-N |
| XLogP | 0.64 |
| TPSA | 65.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |