C20H29N3O3 — CID 169413025
3-[(1R,2S,8R,9S)-8-(hydroxymethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]-1,6-dimethylpyridin-2-one (PubChem CID 169413025) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is 3-[(1R,2S,8R,9S)-8-(hydroxymethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]-1,6-dimethylpyridin-2-one.
| Compound Name | 3-[(1R,2S,8R,9S)-8-(hydroxymethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]-1,6-dimethylpyridin-2-one |
|---|---|
| PubChem CID | 169413025 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 3-[(1R,2S,8R,9S)-8-(hydroxymethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]-1,6-dimethylpyridin-2-one |
| SMILES | Cc1ccc(C(=O)N2C[C@H]3C[C@@H](C2)[C@H](CO)N2CCCC[C@@H]32)c(=O)n1C |
| InChI | InChI=1S/C20H29N3O3/c1-13-6-7-16(19(25)21(13)2)20(26)22-10-14-9-15(11-22)18(12-24)23-8-4-3-5-17(14)23/h6-7,14-15,17-18,24H,3-5,8-12H2,1-2H3/t14-,15+,17+,18+/m1/s1 |
| InChIKey | HQQHBYQJVLTBDU-FZCLSBEQSA-N |
| XLogP | 1.00 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |