C20H27N7O2 — CID 169413181
N-[[(1R,2S,8R,9S)-11-(9-methylpurin-2-yl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]acetamide (PubChem CID 169413181) has the molecular formula C20H27N7O2 and a molecular weight of 397.48 g/mol. Its IUPAC name is N-[[(1R,2S,8R,9S)-11-(9-methylpurin-2-yl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]acetamide.
| Compound Name | N-[[(1R,2S,8R,9S)-11-(9-methylpurin-2-yl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]acetamide |
|---|---|
| PubChem CID | 169413181 |
| Molecular Formula | C20H27N7O2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | N-[[(1R,2S,8R,9S)-11-(9-methylpurin-2-yl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1[C@H]2C[C@H](CN(c3ncc4ncn(C)c4n3)C2)[C@@H]2CCCC(=O)N21 |
| InChI | InChI=1S/C20H27N7O2/c1-12(28)21-8-17-14-6-13(16-4-3-5-18(29)27(16)17)9-26(10-14)20-22-7-15-19(24-20)25(2)11-23-15/h7,11,13-14,16-17H,3-6,8-10H2,1-2H3,(H,21,28)/t13-,14+,16+,17+/m1/s1 |
| InChIKey | WROVDDJJZBBYND-OHFALNGGSA-N |
| XLogP | 0.71 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |