C22H30FN3O3 — CID 169414045
N-[4-[(4aS,7aS)-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-6-carbonyl]cyclohexyl]-2-(3-fluorophenyl)acetamide (PubChem CID 169414045) has the molecular formula C22H30FN3O3 and a molecular weight of 403.50 g/mol. Its IUPAC name is N-[4-[(4aS,7aS)-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-6-carbonyl]cyclohexyl]-2-(3-fluorophenyl)acetamide.
| Compound Name | N-[4-[(4aS,7aS)-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-6-carbonyl]cyclohexyl]-2-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 169414045 |
| Molecular Formula | C22H30FN3O3 |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | N-[4-[(4aS,7aS)-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-6-carbonyl]cyclohexyl]-2-(3-fluorophenyl)acetamide |
| SMILES | CN1CCO[C@H]2CN(C(=O)C3CCC(NC(=O)Cc4cccc(F)c4)CC3)C[C@@H]21 |
| InChI | InChI=1S/C22H30FN3O3/c1-25-9-10-29-20-14-26(13-19(20)25)22(28)16-5-7-18(8-6-16)24-21(27)12-15-3-2-4-17(23)11-15/h2-4,11,16,18-20H,5-10,12-14H2,1H3,(H,24,27)/t16?,18?,19-,20-/m0/s1 |
| InChIKey | BMTPOPKSVNVBKR-QUDVFMAMSA-N |
| XLogP | 1.58 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |