C22H27N5O2 — CID 169414735
(1S,2S,4R)-2-ethyl-N-(pyridin-2-ylmethyl)-7-(1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carbonyl)-7-azabicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 169414735) has the molecular formula C22H27N5O2 and a molecular weight of 393.49 g/mol. Its IUPAC name is (1S,2S,4R)-2-ethyl-N-(pyridin-2-ylmethyl)-7-(1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carbonyl)-7-azabicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1S,2S,4R)-2-ethyl-N-(pyridin-2-ylmethyl)-7-(1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carbonyl)-7-azabicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 169414735 |
| Molecular Formula | C22H27N5O2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | (1S,2S,4R)-2-ethyl-N-(pyridin-2-ylmethyl)-7-(1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carbonyl)-7-azabicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | CC[C@]1(C(=O)NCc2ccccn2)C[C@H]2CC[C@@H]1N2C(=O)c1n[nH]c2c1CCC2 |
| InChI | InChI=1S/C22H27N5O2/c1-2-22(21(29)24-13-14-6-3-4-11-23-14)12-15-9-10-18(22)27(15)20(28)19-16-7-5-8-17(16)25-26-19/h3-4,6,11,15,18H,2,5,7-10,12-13H2,1H3,(H,24,29)(H,25,26)/t15-,18+,22+/m1/s1 |
| InChIKey | ZWBAUWUGDBBIPD-QRFQSNJMSA-N |
| XLogP | 2.38 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |