C16H19N5O2S — CID 169416201
7-(dimethylsulfamoylamino)-4-methyl-2-(1-methylpyrazol-4-yl)quinoline (PubChem CID 169416201) has the molecular formula C16H19N5O2S and a molecular weight of 345.43 g/mol. Its IUPAC name is 7-(dimethylsulfamoylamino)-4-methyl-2-(1-methylpyrazol-4-yl)quinoline.
| Compound Name | 7-(dimethylsulfamoylamino)-4-methyl-2-(1-methylpyrazol-4-yl)quinoline |
|---|---|
| PubChem CID | 169416201 |
| Molecular Formula | C16H19N5O2S |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 7-(dimethylsulfamoylamino)-4-methyl-2-(1-methylpyrazol-4-yl)quinoline |
| SMILES | Cc1cc(-c2cnn(C)c2)nc2cc(NS(=O)(=O)N(C)C)ccc12 |
| InChI | InChI=1S/C16H19N5O2S/c1-11-7-15(12-9-17-21(4)10-12)18-16-8-13(5-6-14(11)16)19-24(22,23)20(2)3/h5-10,19H,1-4H3 |
| InChIKey | CODKXHZYZVSZQB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |