C21H27N5O — CID 169416644
1-(cyclopropylmethyl)-4-[4-(4-methylpiperazin-1-yl)phenyl]-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one (PubChem CID 169416644) has the molecular formula C21H27N5O and a molecular weight of 365.48 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-4-[4-(4-methylpiperazin-1-yl)phenyl]-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one.
| Compound Name | 1-(cyclopropylmethyl)-4-[4-(4-methylpiperazin-1-yl)phenyl]-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one |
|---|---|
| PubChem CID | 169416644 |
| Molecular Formula | C21H27N5O |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | 1-(cyclopropylmethyl)-4-[4-(4-methylpiperazin-1-yl)phenyl]-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one |
| SMILES | CN1CCN(c2ccc(C3CC(=O)Nc4c3cnn4CC3CC3)cc2)CC1 |
| InChI | InChI=1S/C21H27N5O/c1-24-8-10-25(11-9-24)17-6-4-16(5-7-17)18-12-20(27)23-21-19(18)13-22-26(21)14-15-2-3-15/h4-7,13,15,18H,2-3,8-12,14H2,1H3,(H,23,27) |
| InChIKey | MPEICSISMDSOFV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|