About 2-[4-(6-bromo-1,3-benzothiazol-2-yl)piperazin-1-yl]-5-chloro-4-methyl-1,3-benzothiazole
2-[4-(6-bromo-1,3-benzothiazol-2-yl)piperazin-1-yl]-5-chloro-4-methyl-1,3-benzothiazole (PubChem CID 16941669) has the molecular formula C19H16BrClN4S2
and a molecular weight of 479.86 g/mol. Its IUPAC name is 2-[4-(6-bromo-1,3-benzothiazol-2-yl)piperazin-1-yl]-5-chloro-4-methyl-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-[4-(6-bromo-1,3-benzothiazol-2-yl)piperazin-1-yl]-5-chloro-4-methyl-1,3-benzothiazole |
| PubChem CID | 16941669 |
| Molecular Formula | C19H16BrClN4S2 |
| Molecular Weight | 479.86 g/mol |
| Exact Mass | 477.97 |
| IUPAC Name | 2-[4-(6-bromo-1,3-benzothiazol-2-yl)piperazin-1-yl]-5-chloro-4-methyl-1,3-benzothiazole |
| SMILES | Cc1c(Cl)ccc2sc(N3CCN(c4nc5ccc(Br)cc5s4)CC3)nc12 |
| InChI | InChI=1S/C19H16BrClN4S2/c1-11-13(21)3-5-15-17(11)23-19(26-15)25-8-6-24(7-9-25)18-22-14-4-2-12(20)10-16(14)27-18/h2-5,10H,6-9H2,1H3 |
| InChIKey | QVJAQIVFBZVPMK-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.86 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[4-(6-bromo-1,3-benzothiazol-2-yl)piperazin-1-yl]-5-chloro-4-methyl-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(6-bromo-1,3-benzothiazol-2-yl)piperazin-1-yl]-5-chloro-4-methyl-1,3-benzothiazole?
The IUPAC name of 2-[4-(6-bromo-1,3-benzothiazol-2-yl)piperazin-1-yl]-5-chloro-4-methyl-1,3-benzothiazole (CID 16941669) is 2-[4-(6-bromo-1,3-benzothiazol-2-yl)piperazin-1-yl]-5-chloro-4-methyl-1,3-benzothiazole.
What is the SMILES notation for 2-[4-(6-bromo-1,3-benzothiazol-2-yl)piperazin-1-yl]-5-chloro-4-methyl-1,3-benzothiazole?
The canonical SMILES for 2-[4-(6-bromo-1,3-benzothiazol-2-yl)piperazin-1-yl]-5-chloro-4-methyl-1,3-benzothiazole is Cc1c(Cl)ccc2sc(N3CCN(c4nc5ccc(Br)cc5s4)CC3)nc12.
What is the InChIKey of 2-[4-(6-bromo-1,3-benzothiazol-2-yl)piperazin-1-yl]-5-chloro-4-methyl-1,3-benzothiazole?
The InChIKey is QVJAQIVFBZVPMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16BrClN4S2/c1-11-13(21)3-5-15-17(11)23-19(26-15)25-8-6-24(7-9-25)18-22-14-4-2-12(20)10-16(14)27-18/h2-5,10H,6-9H2,1H3.
What are the key properties of 2-[4-(6-bromo-1,3-benzothiazol-2-yl)piperazin-1-yl]-5-chloro-4-methyl-1,3-benzothiazole?
2-[4-(6-bromo-1,3-benzothiazol-2-yl)piperazin-1-yl]-5-chloro-4-methyl-1,3-benzothiazole has a molecular weight of 479.86 g/mol, XLogP of 5.96, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(6-bromo-1,3-benzothiazol-2-yl)piperazin-1-yl]-5-chloro-4-methyl-1,3-benzothiazole is sourced from PubChem (CID 16941669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).