C19H27N7O — CID 169417010
4-amino-6-[(1R,2S,8R,9S)-8-[(dimethylamino)methyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyrimidine-5-carbonitrile (PubChem CID 169417010) has the molecular formula C19H27N7O and a molecular weight of 369.47 g/mol. Its IUPAC name is 4-amino-6-[(1R,2S,8R,9S)-8-[(dimethylamino)methyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyrimidine-5-carbonitrile.
| Compound Name | 4-amino-6-[(1R,2S,8R,9S)-8-[(dimethylamino)methyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 169417010 |
| Molecular Formula | C19H27N7O |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | 4-amino-6-[(1R,2S,8R,9S)-8-[(dimethylamino)methyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyrimidine-5-carbonitrile |
| SMILES | CN(C)C[C@H]1[C@H]2C[C@H](CN(c3ncnc(N)c3C#N)C2)[C@@H]2CCCC(=O)N21 |
| InChI | InChI=1S/C19H27N7O/c1-24(2)10-16-13-6-12(15-4-3-5-17(27)26(15)16)8-25(9-13)19-14(7-20)18(21)22-11-23-19/h11-13,15-16H,3-6,8-10H2,1-2H3,(H2,21,22,23)/t12-,13+,15+,16+/m1/s1 |
| InChIKey | KSJZGGIRDWKBIQ-VRKREXBASA-N |
| XLogP | 0.70 |
| TPSA | 102.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |