C19H26N6O3 — CID 169417722
6-[(1R,2S,8R,9S)-8-(acetamidomethyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyrazine-2-carboxamide (PubChem CID 169417722) has the molecular formula C19H26N6O3 and a molecular weight of 386.46 g/mol. Its IUPAC name is 6-[(1R,2S,8R,9S)-8-(acetamidomethyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyrazine-2-carboxamide.
| Compound Name | 6-[(1R,2S,8R,9S)-8-(acetamidomethyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 169417722 |
| Molecular Formula | C19H26N6O3 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 6-[(1R,2S,8R,9S)-8-(acetamidomethyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyrazine-2-carboxamide |
| SMILES | CC(=O)NC[C@H]1[C@H]2C[C@H](CN(c3cncc(C(N)=O)n3)C2)[C@@H]2CCCC(=O)N21 |
| InChI | InChI=1S/C19H26N6O3/c1-11(26)22-7-16-13-5-12(15-3-2-4-18(27)25(15)16)9-24(10-13)17-8-21-6-14(23-17)19(20)28/h6,8,12-13,15-16H,2-5,7,9-10H2,1H3,(H2,20,28)(H,22,26)/t12-,13+,15+,16+/m1/s1 |
| InChIKey | JJLUSZABDMXOTH-VRKREXBASA-N |
| XLogP | -0.08 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |