C22H26FN3O3 — CID 169418166
N-[[(1R,8R,9S)-11-[(3-fluoro-4-methoxyphenyl)methyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-8-yl]methyl]acetamide (PubChem CID 169418166) has the molecular formula C22H26FN3O3 and a molecular weight of 399.47 g/mol. Its IUPAC name is N-[[(1R,8R,9S)-11-[(3-fluoro-4-methoxyphenyl)methyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-8-yl]methyl]acetamide.
| Compound Name | N-[[(1R,8R,9S)-11-[(3-fluoro-4-methoxyphenyl)methyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-8-yl]methyl]acetamide |
|---|---|
| PubChem CID | 169418166 |
| Molecular Formula | C22H26FN3O3 |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | N-[[(1R,8R,9S)-11-[(3-fluoro-4-methoxyphenyl)methyl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-8-yl]methyl]acetamide |
| SMILES | COc1ccc(CN2C[C@H]3C[C@@H](C2)[C@H](CNC(C)=O)n2c3cccc2=O)cc1F |
| InChI | InChI=1S/C22H26FN3O3/c1-14(27)24-10-20-17-9-16(19-4-3-5-22(28)26(19)20)12-25(13-17)11-15-6-7-21(29-2)18(23)8-15/h3-8,16-17,20H,9-13H2,1-2H3,(H,24,27)/t16-,17+,20+/m1/s1 |
| InChIKey | PDEASMOXGVCANN-UWVAXJGDSA-N |
| XLogP | 2.29 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |