C22H32N4O3 — CID 169418339
(1R,2S,8R,9S)-8-[(dimethylamino)methyl]-11-(1,6-dimethyl-2-oxopyridine-3-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 169418339) has the molecular formula C22H32N4O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is (1R,2S,8R,9S)-8-[(dimethylamino)methyl]-11-(1,6-dimethyl-2-oxopyridine-3-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | (1R,2S,8R,9S)-8-[(dimethylamino)methyl]-11-(1,6-dimethyl-2-oxopyridine-3-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 169418339 |
| Molecular Formula | C22H32N4O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | (1R,2S,8R,9S)-8-[(dimethylamino)methyl]-11-(1,6-dimethyl-2-oxopyridine-3-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | Cc1ccc(C(=O)N2C[C@H]3C[C@@H](C2)[C@H](CN(C)C)N2C(=O)CCC[C@@H]32)c(=O)n1C |
| InChI | InChI=1S/C22H32N4O3/c1-14-8-9-17(21(28)24(14)4)22(29)25-11-15-10-16(12-25)19(13-23(2)3)26-18(15)6-5-7-20(26)27/h8-9,15-16,18-19H,5-7,10-13H2,1-4H3/t15-,16+,18+,19+/m1/s1 |
| InChIKey | KWFPMZVSSWAKNU-NEPXVJNWSA-N |
| XLogP | 1.10 |
| TPSA | 65.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |