About 3-[2-(3,5-dimethyl-1H-pyrazol-4-yl)-4-methylquinolin-8-yl]-N,N-dimethylpropanamide
3-[2-(3,5-dimethyl-1H-pyrazol-4-yl)-4-methylquinolin-8-yl]-N,N-dimethylpropanamide (PubChem CID 169418434) has the molecular formula C20H24N4O
and a molecular weight of 336.44 g/mol. Its IUPAC name is 3-[2-(3,5-dimethyl-1H-pyrazol-4-yl)-4-methylquinolin-8-yl]-N,N-dimethylpropanamide.
Molecular Properties
| Compound Name | 3-[2-(3,5-dimethyl-1H-pyrazol-4-yl)-4-methylquinolin-8-yl]-N,N-dimethylpropanamide |
| PubChem CID | 169418434 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 3-[2-(3,5-dimethyl-1H-pyrazol-4-yl)-4-methylquinolin-8-yl]-N,N-dimethylpropanamide |
| SMILES | Cc1n[nH]c(C)c1-c1cc(C)c2cccc(CCC(=O)N(C)C)c2n1 |
| InChI | InChI=1S/C20H24N4O/c1-12-11-17(19-13(2)22-23-14(19)3)21-20-15(7-6-8-16(12)20)9-10-18(25)24(4)5/h6-8,11H,9-10H2,1-5H3,(H,22,23) |
| InChIKey | BWYXYQRGIKARDP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[2-(3,5-dimethyl-1H-pyrazol-4-yl)-4-methylquinolin-8-yl]-N,N-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(3,5-dimethyl-1H-pyrazol-4-yl)-4-methylquinolin-8-yl]-N,N-dimethylpropanamide?
The IUPAC name of 3-[2-(3,5-dimethyl-1H-pyrazol-4-yl)-4-methylquinolin-8-yl]-N,N-dimethylpropanamide (CID 169418434) is 3-[2-(3,5-dimethyl-1H-pyrazol-4-yl)-4-methylquinolin-8-yl]-N,N-dimethylpropanamide.
What is the SMILES notation for 3-[2-(3,5-dimethyl-1H-pyrazol-4-yl)-4-methylquinolin-8-yl]-N,N-dimethylpropanamide?
The canonical SMILES for 3-[2-(3,5-dimethyl-1H-pyrazol-4-yl)-4-methylquinolin-8-yl]-N,N-dimethylpropanamide is Cc1n[nH]c(C)c1-c1cc(C)c2cccc(CCC(=O)N(C)C)c2n1.
What is the InChIKey of 3-[2-(3,5-dimethyl-1H-pyrazol-4-yl)-4-methylquinolin-8-yl]-N,N-dimethylpropanamide?
The InChIKey is BWYXYQRGIKARDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N4O/c1-12-11-17(19-13(2)22-23-14(19)3)21-20-15(7-6-8-16(12)20)9-10-18(25)24(4)5/h6-8,11H,9-10H2,1-5H3,(H,22,23).
What are the key properties of 3-[2-(3,5-dimethyl-1H-pyrazol-4-yl)-4-methylquinolin-8-yl]-N,N-dimethylpropanamide?
3-[2-(3,5-dimethyl-1H-pyrazol-4-yl)-4-methylquinolin-8-yl]-N,N-dimethylpropanamide has a molecular weight of 336.44 g/mol, XLogP of 3.57, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(3,5-dimethyl-1H-pyrazol-4-yl)-4-methylquinolin-8-yl]-N,N-dimethylpropanamide is sourced from PubChem (CID 169418434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).