C15H17FN4O2S — CID 16942064
N-[6-(cyclopentylamino)pyridazin-3-yl]-4-fluorobenzenesulfonamide (PubChem CID 16942064) has the molecular formula C15H17FN4O2S and a molecular weight of 336.39 g/mol. Its IUPAC name is N-[6-(cyclopentylamino)pyridazin-3-yl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[6-(cyclopentylamino)pyridazin-3-yl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 16942064 |
| Molecular Formula | C15H17FN4O2S |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N-[6-(cyclopentylamino)pyridazin-3-yl]-4-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(NC2CCCC2)nn1)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H17FN4O2S/c16-11-5-7-13(8-6-11)23(21,22)20-15-10-9-14(18-19-15)17-12-3-1-2-4-12/h5-10,12H,1-4H2,(H,17,18)(H,19,20) |
| InChIKey | ODUKNYBSDIYNAS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |