About 2-[2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-4-methylquinolin-6-yl]-N-methylacetamide
2-[2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-4-methylquinolin-6-yl]-N-methylacetamide (PubChem CID 169420696) has the molecular formula C21H26N4O
and a molecular weight of 350.47 g/mol. Its IUPAC name is 2-[2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-4-methylquinolin-6-yl]-N-methylacetamide.
Molecular Properties
| Compound Name | 2-[2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-4-methylquinolin-6-yl]-N-methylacetamide |
| PubChem CID | 169420696 |
| Molecular Formula | C21H26N4O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 2-[2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-4-methylquinolin-6-yl]-N-methylacetamide |
| SMILES | CNC(=O)Cc1ccc2nc(-c3c(C)nn(C(C)C)c3C)cc(C)c2c1 |
| InChI | InChI=1S/C21H26N4O/c1-12(2)25-15(5)21(14(4)24-25)19-9-13(3)17-10-16(11-20(26)22-6)7-8-18(17)23-19/h7-10,12H,11H2,1-6H3,(H,22,26) |
| InChIKey | LYFAVLAXNAPZSB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-4-methylquinolin-6-yl]-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-4-methylquinolin-6-yl]-N-methylacetamide?
The IUPAC name of 2-[2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-4-methylquinolin-6-yl]-N-methylacetamide (CID 169420696) is 2-[2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-4-methylquinolin-6-yl]-N-methylacetamide.
What is the SMILES notation for 2-[2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-4-methylquinolin-6-yl]-N-methylacetamide?
The canonical SMILES for 2-[2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-4-methylquinolin-6-yl]-N-methylacetamide is CNC(=O)Cc1ccc2nc(-c3c(C)nn(C(C)C)c3C)cc(C)c2c1.
What is the InChIKey of 2-[2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-4-methylquinolin-6-yl]-N-methylacetamide?
The InChIKey is LYFAVLAXNAPZSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N4O/c1-12(2)25-15(5)21(14(4)24-25)19-9-13(3)17-10-16(11-20(26)22-6)7-8-18(17)23-19/h7-10,12H,11H2,1-6H3,(H,22,26).
What are the key properties of 2-[2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-4-methylquinolin-6-yl]-N-methylacetamide?
2-[2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-4-methylquinolin-6-yl]-N-methylacetamide has a molecular weight of 350.47 g/mol, XLogP of 3.89, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)-4-methylquinolin-6-yl]-N-methylacetamide is sourced from PubChem (CID 169420696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).