C17H16F3N3O — CID 169421207
2-[3-methyl-4-[4-methyl-6-(trifluoromethyl)quinolin-2-yl]pyrazol-1-yl]ethanol (PubChem CID 169421207) has the molecular formula C17H16F3N3O and a molecular weight of 335.33 g/mol. Its IUPAC name is 2-[3-methyl-4-[4-methyl-6-(trifluoromethyl)quinolin-2-yl]pyrazol-1-yl]ethanol.
| Compound Name | 2-[3-methyl-4-[4-methyl-6-(trifluoromethyl)quinolin-2-yl]pyrazol-1-yl]ethanol |
|---|---|
| PubChem CID | 169421207 |
| Molecular Formula | C17H16F3N3O |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 2-[3-methyl-4-[4-methyl-6-(trifluoromethyl)quinolin-2-yl]pyrazol-1-yl]ethanol |
| SMILES | Cc1nn(CCO)cc1-c1cc(C)c2cc(C(F)(F)F)ccc2n1 |
| InChI | InChI=1S/C17H16F3N3O/c1-10-7-16(14-9-23(5-6-24)22-11(14)2)21-15-4-3-12(8-13(10)15)17(18,19)20/h3-4,7-9,24H,5-6H2,1-2H3 |
| InChIKey | MYLKDSDHHAMAML-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |