C24H23N3O3 — CID 169421607
N-methyl-2-[3-[[4-[2-(methylamino)-2-oxoethyl]phenyl]carbamoyl]phenyl]benzamide (PubChem CID 169421607) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is N-methyl-2-[3-[[4-[2-(methylamino)-2-oxoethyl]phenyl]carbamoyl]phenyl]benzamide.
| Compound Name | N-methyl-2-[3-[[4-[2-(methylamino)-2-oxoethyl]phenyl]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 169421607 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | N-methyl-2-[3-[[4-[2-(methylamino)-2-oxoethyl]phenyl]carbamoyl]phenyl]benzamide |
| SMILES | CNC(=O)Cc1ccc(NC(=O)c2cccc(-c3ccccc3C(=O)NC)c2)cc1 |
| InChI | InChI=1S/C24H23N3O3/c1-25-22(28)14-16-10-12-19(13-11-16)27-23(29)18-7-5-6-17(15-18)20-8-3-4-9-21(20)24(30)26-2/h3-13,15H,14H2,1-2H3,(H,25,28)(H,26,30)(H,27,29) |
| InChIKey | ACBZGGYBRXUCRT-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |