About 2-(2,3-dimethylimidazol-4-yl)-4-methyl-6-[2-(4-methylpiperazin-1-yl)ethyl]quinoline
2-(2,3-dimethylimidazol-4-yl)-4-methyl-6-[2-(4-methylpiperazin-1-yl)ethyl]quinoline (PubChem CID 169421949) has the molecular formula C22H29N5
and a molecular weight of 363.51 g/mol. Its IUPAC name is 2-(2,3-dimethylimidazol-4-yl)-4-methyl-6-[2-(4-methylpiperazin-1-yl)ethyl]quinoline.
Molecular Properties
| Compound Name | 2-(2,3-dimethylimidazol-4-yl)-4-methyl-6-[2-(4-methylpiperazin-1-yl)ethyl]quinoline |
| PubChem CID | 169421949 |
| Molecular Formula | C22H29N5 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | 2-(2,3-dimethylimidazol-4-yl)-4-methyl-6-[2-(4-methylpiperazin-1-yl)ethyl]quinoline |
| SMILES | Cc1cc(-c2cnc(C)n2C)nc2ccc(CCN3CCN(C)CC3)cc12 |
| InChI | InChI=1S/C22H29N5/c1-16-13-21(22-15-23-17(2)26(22)4)24-20-6-5-18(14-19(16)20)7-8-27-11-9-25(3)10-12-27/h5-6,13-15H,7-12H2,1-4H3 |
| InChIKey | JPXDAEOJYCSFHE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2,3-dimethylimidazol-4-yl)-4-methyl-6-[2-(4-methylpiperazin-1-yl)ethyl]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dimethylimidazol-4-yl)-4-methyl-6-[2-(4-methylpiperazin-1-yl)ethyl]quinoline?
The IUPAC name of 2-(2,3-dimethylimidazol-4-yl)-4-methyl-6-[2-(4-methylpiperazin-1-yl)ethyl]quinoline (CID 169421949) is 2-(2,3-dimethylimidazol-4-yl)-4-methyl-6-[2-(4-methylpiperazin-1-yl)ethyl]quinoline.
What is the SMILES notation for 2-(2,3-dimethylimidazol-4-yl)-4-methyl-6-[2-(4-methylpiperazin-1-yl)ethyl]quinoline?
The canonical SMILES for 2-(2,3-dimethylimidazol-4-yl)-4-methyl-6-[2-(4-methylpiperazin-1-yl)ethyl]quinoline is Cc1cc(-c2cnc(C)n2C)nc2ccc(CCN3CCN(C)CC3)cc12.
What is the InChIKey of 2-(2,3-dimethylimidazol-4-yl)-4-methyl-6-[2-(4-methylpiperazin-1-yl)ethyl]quinoline?
The InChIKey is JPXDAEOJYCSFHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29N5/c1-16-13-21(22-15-23-17(2)26(22)4)24-20-6-5-18(14-19(16)20)7-8-27-11-9-25(3)10-12-27/h5-6,13-15H,7-12H2,1-4H3.
What are the key properties of 2-(2,3-dimethylimidazol-4-yl)-4-methyl-6-[2-(4-methylpiperazin-1-yl)ethyl]quinoline?
2-(2,3-dimethylimidazol-4-yl)-4-methyl-6-[2-(4-methylpiperazin-1-yl)ethyl]quinoline has a molecular weight of 363.51 g/mol, XLogP of 3.04, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dimethylimidazol-4-yl)-4-methyl-6-[2-(4-methylpiperazin-1-yl)ethyl]quinoline is sourced from PubChem (CID 169421949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).