C17H15N3OS — CID 169422309
1-[4-methyl-2-(1,3-thiazol-4-yl)quinolin-6-yl]pyrrolidin-2-one (PubChem CID 169422309) has the molecular formula C17H15N3OS and a molecular weight of 309.39 g/mol. Its IUPAC name is 1-[4-methyl-2-(1,3-thiazol-4-yl)quinolin-6-yl]pyrrolidin-2-one.
| Compound Name | 1-[4-methyl-2-(1,3-thiazol-4-yl)quinolin-6-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 169422309 |
| Molecular Formula | C17H15N3OS |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 1-[4-methyl-2-(1,3-thiazol-4-yl)quinolin-6-yl]pyrrolidin-2-one |
| SMILES | Cc1cc(-c2cscn2)nc2ccc(N3CCCC3=O)cc12 |
| InChI | InChI=1S/C17H15N3OS/c1-11-7-15(16-9-22-10-18-16)19-14-5-4-12(8-13(11)14)20-6-2-3-17(20)21/h4-5,7-10H,2-3,6H2,1H3 |
| InChIKey | ADLHWVXMNHNLKB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |