About 5-(2-fluoro-6-methylphenyl)-3-(1-methylpyrazol-4-yl)-3H-pyrazolo[4,3-c]pyridazin-6-one
5-(2-fluoro-6-methylphenyl)-3-(1-methylpyrazol-4-yl)-3H-pyrazolo[4,3-c]pyridazin-6-one (PubChem CID 169422904) has the molecular formula C16H13FN6O
and a molecular weight of 324.32 g/mol. Its IUPAC name is 5-(2-fluoro-6-methylphenyl)-3-(1-methylpyrazol-4-yl)-3H-pyrazolo[4,3-c]pyridazin-6-one.
Molecular Properties
| Compound Name | 5-(2-fluoro-6-methylphenyl)-3-(1-methylpyrazol-4-yl)-3H-pyrazolo[4,3-c]pyridazin-6-one |
| PubChem CID | 169422904 |
| Molecular Formula | C16H13FN6O |
| Molecular Weight | 324.32 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 5-(2-fluoro-6-methylphenyl)-3-(1-methylpyrazol-4-yl)-3H-pyrazolo[4,3-c]pyridazin-6-one |
| SMILES | Cc1cccc(F)c1-n1nc2c(cc1=O)N=NC2c1cnn(C)c1 |
| InChI | InChI=1S/C16H13FN6O/c1-9-4-3-5-11(17)16(9)23-13(24)6-12-15(21-23)14(20-19-12)10-7-18-22(2)8-10/h3-8,14H,1-2H3 |
| InChIKey | QKUHJWBVJZULAS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-(2-fluoro-6-methylphenyl)-3-(1-methylpyrazol-4-yl)-3H-pyrazolo[4,3-c]pyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-fluoro-6-methylphenyl)-3-(1-methylpyrazol-4-yl)-3H-pyrazolo[4,3-c]pyridazin-6-one?
The IUPAC name of 5-(2-fluoro-6-methylphenyl)-3-(1-methylpyrazol-4-yl)-3H-pyrazolo[4,3-c]pyridazin-6-one (CID 169422904) is 5-(2-fluoro-6-methylphenyl)-3-(1-methylpyrazol-4-yl)-3H-pyrazolo[4,3-c]pyridazin-6-one.
What is the SMILES notation for 5-(2-fluoro-6-methylphenyl)-3-(1-methylpyrazol-4-yl)-3H-pyrazolo[4,3-c]pyridazin-6-one?
The canonical SMILES for 5-(2-fluoro-6-methylphenyl)-3-(1-methylpyrazol-4-yl)-3H-pyrazolo[4,3-c]pyridazin-6-one is Cc1cccc(F)c1-n1nc2c(cc1=O)N=NC2c1cnn(C)c1.
What is the InChIKey of 5-(2-fluoro-6-methylphenyl)-3-(1-methylpyrazol-4-yl)-3H-pyrazolo[4,3-c]pyridazin-6-one?
The InChIKey is QKUHJWBVJZULAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13FN6O/c1-9-4-3-5-11(17)16(9)23-13(24)6-12-15(21-23)14(20-19-12)10-7-18-22(2)8-10/h3-8,14H,1-2H3.
What are the key properties of 5-(2-fluoro-6-methylphenyl)-3-(1-methylpyrazol-4-yl)-3H-pyrazolo[4,3-c]pyridazin-6-one?
5-(2-fluoro-6-methylphenyl)-3-(1-methylpyrazol-4-yl)-3H-pyrazolo[4,3-c]pyridazin-6-one has a molecular weight of 324.32 g/mol, XLogP of 2.60, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-fluoro-6-methylphenyl)-3-(1-methylpyrazol-4-yl)-3H-pyrazolo[4,3-c]pyridazin-6-one is sourced from PubChem (CID 169422904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).