C21H27FN8O2 — CID 169422913
5-(2-fluoro-6-methoxyphenyl)-3-[2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]-2,3,3a,4,7,7a-hexahydro-1H-pyrazolo[4,3-c]pyridazin-6-one (PubChem CID 169422913) has the molecular formula C21H27FN8O2 and a molecular weight of 442.50 g/mol. Its IUPAC name is 5-(2-fluoro-6-methoxyphenyl)-3-[2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]-2,3,3a,4,7,7a-hexahydro-1H-pyrazolo[4,3-c]pyridazin-6-one.
| Compound Name | 5-(2-fluoro-6-methoxyphenyl)-3-[2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]-2,3,3a,4,7,7a-hexahydro-1H-pyrazolo[4,3-c]pyridazin-6-one |
|---|---|
| PubChem CID | 169422913 |
| Molecular Formula | C21H27FN8O2 |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | 5-(2-fluoro-6-methoxyphenyl)-3-[2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]-2,3,3a,4,7,7a-hexahydro-1H-pyrazolo[4,3-c]pyridazin-6-one |
| SMILES | COc1cccc(F)c1N1NC2C(CC1=O)NNC2c1cnc(N2CCN(C)CC2)nc1 |
| InChI | InChI=1S/C21H27FN8O2/c1-28-6-8-29(9-7-28)21-23-11-13(12-24-21)18-19-15(25-26-18)10-17(31)30(27-19)20-14(22)4-3-5-16(20)32-2/h3-5,11-12,15,18-19,25-27H,6-10H2,1-2H3 |
| InChIKey | GXDCYIICDYGUPS-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 97.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |