C30H34ClF6N9 — CID 169424124
4-chloro-N-(1-phenylpentan-3-yl)-6-(trifluoromethyl)-1,3,5-triazin-2-amine;2-N-(1-phenylpentan-3-yl)-6-(trifluoromethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 169424124) has the molecular formula C30H34ClF6N9 and a molecular weight of 670.11 g/mol. Its IUPAC name is 4-chloro-N-(1-phenylpentan-3-yl)-6-(trifluoromethyl)-1,3,5-triazin-2-amine;2-N-(1-phenylpentan-3-yl)-6-(trifluoromethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-chloro-N-(1-phenylpentan-3-yl)-6-(trifluoromethyl)-1,3,5-triazin-2-amine;2-N-(1-phenylpentan-3-yl)-6-(trifluoromethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 169424124 |
| Molecular Formula | C30H34ClF6N9 |
| Molecular Weight | 670.11 g/mol |
| Exact Mass | 669.25 |
| IUPAC Name | 4-chloro-N-(1-phenylpentan-3-yl)-6-(trifluoromethyl)-1,3,5-triazin-2-amine;2-N-(1-phenylpentan-3-yl)-6-(trifluoromethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCC(CCc1ccccc1)Nc1nc(Cl)nc(C(F)(F)F)n1.CCC(CCc1ccccc1)Nc1nc(N)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C15H16ClF3N4.C15H18F3N5/c1-2-11(9-8-10-6-4-3-5-7-10)20-14-22-12(15(17,18)19)21-13(16)23-14;1-2-11(9-8-10-6-4-3-5-7-10)20-14-22-12(15(16,17)18)21-13(19)23-14/h3-7,11H,2,8-9H2,1H3,(H,20,21,22,23);3-7,11H,2,8-9H2,1H3,(H3,19,20,21,22,23) |
| InChIKey | BNGVJMJGFYBPRD-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 127.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.11 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |