C11H22Na2O7P2 — CID 169424489
disodium;[1-hydroxy-1-phosphonato-2-(3,3,4,4-tetramethylcyclopentyl)ethyl]phosphonic acid (PubChem CID 169424489) has the molecular formula C11H22Na2O7P2 and a molecular weight of 374.22 g/mol. Its IUPAC name is disodium;[1-hydroxy-1-phosphonato-2-(3,3,4,4-tetramethylcyclopentyl)ethyl]phosphonic acid.
| Compound Name | disodium;[1-hydroxy-1-phosphonato-2-(3,3,4,4-tetramethylcyclopentyl)ethyl]phosphonic acid |
|---|---|
| PubChem CID | 169424489 |
| Molecular Formula | C11H22Na2O7P2 |
| Molecular Weight | 374.22 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | disodium;[1-hydroxy-1-phosphonato-2-(3,3,4,4-tetramethylcyclopentyl)ethyl]phosphonic acid |
| SMILES | CC1(C)CC(CC(O)(P(=O)([O-])[O-])P(=O)(O)O)CC1(C)C.[Na+].[Na+] |
| InChI | InChI=1S/C11H24O7P2.2Na/c1-9(2)5-8(6-10(9,3)4)7-11(12,19(13,14)15)20(16,17)18;;/h8,12H,5-7H2,1-4H3,(H2,13,14,15)(H2,16,17,18);;/q;2*+1/p-2 |
| InChIKey | CPPKBWVSTDIYLE-UHFFFAOYSA-L |
| XLogP | -5.42 |
| TPSA | 140.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.22 |
| LogP ≤ 5 | -5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|