C11H20ClF7N2O2S — CID 169424826
trimethyl-[3-[[3,4,4,4-tetrafluoro-3-(trifluoromethyl)butyl]sulfonylamino]propyl]azanium chloride (PubChem CID 169424826) has the molecular formula C11H20ClF7N2O2S and a molecular weight of 412.80 g/mol. Its IUPAC name is trimethyl-[3-[[3,4,4,4-tetrafluoro-3-(trifluoromethyl)butyl]sulfonylamino]propyl]azanium chloride.
| Compound Name | trimethyl-[3-[[3,4,4,4-tetrafluoro-3-(trifluoromethyl)butyl]sulfonylamino]propyl]azanium chloride |
|---|---|
| PubChem CID | 169424826 |
| Molecular Formula | C11H20ClF7N2O2S |
| Molecular Weight | 412.80 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | trimethyl-[3-[[3,4,4,4-tetrafluoro-3-(trifluoromethyl)butyl]sulfonylamino]propyl]azanium chloride |
| SMILES | C[N+](C)(C)CCCNS(=O)(=O)CCC(F)(C(F)(F)F)C(F)(F)F.[Cl-] |
| InChI | InChI=1S/C11H20F7N2O2S.ClH/c1-20(2,3)7-4-6-19-23(21,22)8-5-9(12,10(13,14)15)11(16,17)18;/h19H,4-8H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | LASYXQWORPERDR-UHFFFAOYSA-M |
| XLogP | -0.77 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.80 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|