About N-(4-methoxyphenyl)-N,2-dimethyl-5H-cyclopenta[d]pyrimidin-4-amine;hydrochloride
N-(4-methoxyphenyl)-N,2-dimethyl-5H-cyclopenta[d]pyrimidin-4-amine;hydrochloride (PubChem CID 169425423) has the molecular formula C16H18ClN3O
and a molecular weight of 303.79 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-N,2-dimethyl-5H-cyclopenta[d]pyrimidin-4-amine;hydrochloride.
Molecular Properties
| Compound Name | N-(4-methoxyphenyl)-N,2-dimethyl-5H-cyclopenta[d]pyrimidin-4-amine;hydrochloride |
| PubChem CID | 169425423 |
| Molecular Formula | C16H18ClN3O |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | N-(4-methoxyphenyl)-N,2-dimethyl-5H-cyclopenta[d]pyrimidin-4-amine;hydrochloride |
| SMILES | COc1ccc(N(C)c2nc(C)nc3c2CC=C3)cc1.Cl |
| InChI | InChI=1S/C16H17N3O.ClH/c1-11-17-15-6-4-5-14(15)16(18-11)19(2)12-7-9-13(20-3)10-8-12;/h4,6-10H,5H2,1-3H3;1H |
| InChIKey | CTXRVBIAWJVRPE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(4-methoxyphenyl)-N,2-dimethyl-5H-cyclopenta[d]pyrimidin-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-methoxyphenyl)-N,2-dimethyl-5H-cyclopenta[d]pyrimidin-4-amine;hydrochloride?
The IUPAC name of N-(4-methoxyphenyl)-N,2-dimethyl-5H-cyclopenta[d]pyrimidin-4-amine;hydrochloride (CID 169425423) is N-(4-methoxyphenyl)-N,2-dimethyl-5H-cyclopenta[d]pyrimidin-4-amine;hydrochloride.
What is the SMILES notation for N-(4-methoxyphenyl)-N,2-dimethyl-5H-cyclopenta[d]pyrimidin-4-amine;hydrochloride?
The canonical SMILES for N-(4-methoxyphenyl)-N,2-dimethyl-5H-cyclopenta[d]pyrimidin-4-amine;hydrochloride is COc1ccc(N(C)c2nc(C)nc3c2CC=C3)cc1.Cl.
What is the InChIKey of N-(4-methoxyphenyl)-N,2-dimethyl-5H-cyclopenta[d]pyrimidin-4-amine;hydrochloride?
The InChIKey is CTXRVBIAWJVRPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O.ClH/c1-11-17-15-6-4-5-14(15)16(18-11)19(2)12-7-9-13(20-3)10-8-12;/h4,6-10H,5H2,1-3H3;1H.
What are the key properties of N-(4-methoxyphenyl)-N,2-dimethyl-5H-cyclopenta[d]pyrimidin-4-amine;hydrochloride?
N-(4-methoxyphenyl)-N,2-dimethyl-5H-cyclopenta[d]pyrimidin-4-amine;hydrochloride has a molecular weight of 303.79 g/mol, XLogP of 3.55, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-methoxyphenyl)-N,2-dimethyl-5H-cyclopenta[d]pyrimidin-4-amine;hydrochloride is sourced from PubChem (CID 169425423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).