About (2R)-2-methylpentanal;(2R)-2-methylpentan-1-ol
(2R)-2-methylpentanal;(2R)-2-methylpentan-1-ol (PubChem CID 169425756) has the molecular formula C12H26O2
and a molecular weight of 202.34 g/mol. Its IUPAC name is (2R)-2-methylpentanal;(2R)-2-methylpentan-1-ol.
Molecular Properties
| Compound Name | (2R)-2-methylpentanal;(2R)-2-methylpentan-1-ol |
| PubChem CID | 169425756 |
| Molecular Formula | C12H26O2 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.19 |
| IUPAC Name | (2R)-2-methylpentanal;(2R)-2-methylpentan-1-ol |
| SMILES | CCC[C@@H](C)C=O.CCC[C@@H](C)CO |
| InChI | InChI=1S/C6H14O.C6H12O/c2*1-3-4-6(2)5-7/h6-7H,3-5H2,1-2H3;5-6H,3-4H2,1-2H3/t2*6-/m11/s1 |
| InChIKey | HORYIBONTFJEDA-BYZBDTJCSA-N |
| XLogP | 3.04 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-methylpentanal;(2R)-2-methylpentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-methylpentanal;(2R)-2-methylpentan-1-ol?
The IUPAC name of (2R)-2-methylpentanal;(2R)-2-methylpentan-1-ol (CID 169425756) is (2R)-2-methylpentanal;(2R)-2-methylpentan-1-ol.
What is the SMILES notation for (2R)-2-methylpentanal;(2R)-2-methylpentan-1-ol?
The canonical SMILES for (2R)-2-methylpentanal;(2R)-2-methylpentan-1-ol is CCC[C@@H](C)C=O.CCC[C@@H](C)CO.
What is the InChIKey of (2R)-2-methylpentanal;(2R)-2-methylpentan-1-ol?
The InChIKey is HORYIBONTFJEDA-BYZBDTJCSA-N. The full InChI is InChI=1S/C6H14O.C6H12O/c2*1-3-4-6(2)5-7/h6-7H,3-5H2,1-2H3;5-6H,3-4H2,1-2H3/t2*6-/m11/s1.
What are the key properties of (2R)-2-methylpentanal;(2R)-2-methylpentan-1-ol?
(2R)-2-methylpentanal;(2R)-2-methylpentan-1-ol has a molecular weight of 202.34 g/mol, XLogP of 3.04, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-methylpentanal;(2R)-2-methylpentan-1-ol is sourced from PubChem (CID 169425756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).