C19H29Cl3N10 — CID 169426364
(3R,5S)-1-[4-[(3R,5S)-3,5-diaminopiperidin-1-yl]-6-(3,4-dichloroanilino)-1,3,5-triazin-2-yl]piperidine-3,5-diamine;hydrochloride (PubChem CID 169426364) has the molecular formula C19H29Cl3N10 and a molecular weight of 503.87 g/mol. Its IUPAC name is (3R,5S)-1-[4-[(3R,5S)-3,5-diaminopiperidin-1-yl]-6-(3,4-dichloroanilino)-1,3,5-triazin-2-yl]piperidine-3,5-diamine;hydrochloride.
| Compound Name | (3R,5S)-1-[4-[(3R,5S)-3,5-diaminopiperidin-1-yl]-6-(3,4-dichloroanilino)-1,3,5-triazin-2-yl]piperidine-3,5-diamine;hydrochloride |
|---|---|
| PubChem CID | 169426364 |
| Molecular Formula | C19H29Cl3N10 |
| Molecular Weight | 503.87 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | (3R,5S)-1-[4-[(3R,5S)-3,5-diaminopiperidin-1-yl]-6-(3,4-dichloroanilino)-1,3,5-triazin-2-yl]piperidine-3,5-diamine;hydrochloride |
| SMILES | Cl.N[C@@H]1C[C@H](N)CN(c2nc(Nc3ccc(Cl)c(Cl)c3)nc(N3C[C@H](N)C[C@H](N)C3)n2)C1 |
| InChI | InChI=1S/C19H28Cl2N10.ClH/c20-15-2-1-14(5-16(15)21)26-17-27-18(30-6-10(22)3-11(23)7-30)29-19(28-17)31-8-12(24)4-13(25)9-31;/h1-2,5,10-13H,3-4,6-9,22-25H2,(H,26,27,28,29);1H/t10-,11+,12-,13+; |
| InChIKey | YEKRAAHFUCVMEJ-KRGUQRPASA-N |
| XLogP | 1.07 |
| TPSA | 161.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.87 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |