C15H30N2O4 — CID 169427843
tert-butyl 4-hydroxypiperidine-1-carboxylate;piperidin-4-ol (PubChem CID 169427843) has the molecular formula C15H30N2O4 and a molecular weight of 302.42 g/mol. Its IUPAC name is tert-butyl 4-hydroxypiperidine-1-carboxylate;piperidin-4-ol.
| Compound Name | tert-butyl 4-hydroxypiperidine-1-carboxylate;piperidin-4-ol |
|---|---|
| PubChem CID | 169427843 |
| Molecular Formula | C15H30N2O4 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | tert-butyl 4-hydroxypiperidine-1-carboxylate;piperidin-4-ol |
| SMILES | CC(C)(C)OC(=O)N1CCC(O)CC1.OC1CCNCC1 |
| InChI | InChI=1S/C10H19NO3.C5H11NO/c1-10(2,3)14-9(13)11-6-4-8(12)5-7-11;7-5-1-3-6-4-2-5/h8,12H,4-7H2,1-3H3;5-7H,1-4H2 |
| InChIKey | NPMLAFCTRRQRJD-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |