C12H14ClFN2 — CID 169428435
6-fluoro-5-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indole;hydrochloride (PubChem CID 169428435) has the molecular formula C12H14ClFN2 and a molecular weight of 240.71 g/mol. Its IUPAC name is 6-fluoro-5-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indole;hydrochloride.
| Compound Name | 6-fluoro-5-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indole;hydrochloride |
|---|---|
| PubChem CID | 169428435 |
| Molecular Formula | C12H14ClFN2 |
| Molecular Weight | 240.71 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 6-fluoro-5-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indole;hydrochloride |
| SMILES | Cl.Cn1c2c(c3cccc(F)c31)CNCC2 |
| InChI | InChI=1S/C12H13FN2.ClH/c1-15-11-5-6-14-7-9(11)8-3-2-4-10(13)12(8)15;/h2-4,14H,5-7H2,1H3;1H |
| InChIKey | KXJHSAFOCVEGSE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.71 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|